About (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride
(3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride (PubChem CID 173374067) has the molecular formula C10H20ClNO4
and a molecular weight of 253.73 g/mol. Its IUPAC name is (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride.
Molecular Properties
| Compound Name | (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride |
| PubChem CID | 173374067 |
| Molecular Formula | C10H20ClNO4 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride |
| SMILES | CC(=O)OC(C)C(=O)OC(C)(C)C(C)N.Cl |
| InChI | InChI=1S/C10H19NO4.ClH/c1-6(14-8(3)12)9(13)15-10(4,5)7(2)11;/h6-7H,11H2,1-5H3;1H |
| InChIKey | ZPGJSTVCHSVOQX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride?
The IUPAC name of (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride (CID 173374067) is (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride.
What is the SMILES notation for (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride?
The canonical SMILES for (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride is CC(=O)OC(C)C(=O)OC(C)(C)C(C)N.Cl.
What is the InChIKey of (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride?
The InChIKey is ZPGJSTVCHSVOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4.ClH/c1-6(14-8(3)12)9(13)15-10(4,5)7(2)11;/h6-7H,11H2,1-5H3;1H.
What are the key properties of (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride?
(3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride has a molecular weight of 253.73 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2-methylbutan-2-yl) 2-acetyloxypropanoate;hydrochloride is sourced from PubChem (CID 173374067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).