C36H29N3S — CID 171580328
2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]-7-phenylquinoline-8-thiol (PubChem CID 171580328) has the molecular formula C36H29N3S and a molecular weight of 535.72 g/mol. Its IUPAC name is 2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]-7-phenylquinoline-8-thiol.
| Compound Name | 2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]-7-phenylquinoline-8-thiol |
|---|---|
| PubChem CID | 171580328 |
| Molecular Formula | C36H29N3S |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]-7-phenylquinoline-8-thiol |
| SMILES | Cc1ccnc(N2c3ccccc3C(C)(C)c3ccc(-c4ccc5ccc(-c6ccccc6)c(S)c5n4)cc32)c1 |
| InChI | InChI=1S/C36H29N3S/c1-23-19-20-37-33(21-23)39-31-12-8-7-11-28(31)36(2,3)29-17-14-26(22-32(29)39)30-18-15-25-13-16-27(35(40)34(25)38-30)24-9-5-4-6-10-24/h4-22,40H,1-3H3 |
| InChIKey | KUSIQIMXRFWLKQ-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 29.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|