C46H37N3O — CID 171580248
2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]acridin-3-yl]-7-(2-phenylethynyl)quinolin-8-ol (PubChem CID 171580248) has the molecular formula C46H37N3O and a molecular weight of 647.82 g/mol. Its IUPAC name is 2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]acridin-3-yl]-7-(2-phenylethynyl)quinolin-8-ol.
| Compound Name | 2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]acridin-3-yl]-7-(2-phenylethynyl)quinolin-8-ol |
|---|---|
| PubChem CID | 171580248 |
| Molecular Formula | C46H37N3O |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | 2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]acridin-3-yl]-7-(2-phenylethynyl)quinolin-8-ol |
| SMILES | Cc1cc(C)c(-c2ccnc(N3c4ccccc4C(C)(C)c4ccc(-c5ccc6ccc(C#Cc7ccccc7)c(O)c6n5)cc43)c2)c(C)c1 |
| InChI | InChI=1S/C46H37N3O/c1-29-25-30(2)43(31(3)26-29)36-23-24-47-42(28-36)49-40-14-10-9-13-37(40)46(4,5)38-21-19-35(27-41(38)49)39-22-20-33-17-18-34(45(50)44(33)48-39)16-15-32-11-7-6-8-12-32/h6-14,17-28,50H,1-5H3 |
| InChIKey | CQCPGPNPQAIWLS-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|