C41H38N3OPt- — CID 171579724
2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]-5-propan-2-ylquinolin-8-ol;platinum (PubChem CID 171579724) has the molecular formula C41H38N3OPt- and a molecular weight of 783.85 g/mol. Its IUPAC name is 2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]-5-propan-2-ylquinolin-8-ol;platinum.
| Compound Name | 2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]-5-propan-2-ylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171579724 |
| Molecular Formula | C41H38N3OPt- |
| Molecular Weight | 783.85 g/mol |
| Exact Mass | 783.27 |
| IUPAC Name | 2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]-5-propan-2-ylquinolin-8-ol;platinum |
| SMILES | Cc1cc(C)c(-c2ccnc(N3c4[c-]c(-c5ccc6c(C(C)C)ccc(O)c6n5)ccc4C(C)(C)c4ccccc43)c2)c(C)c1.[Pt] |
| InChI | InChI=1S/C41H38N3O.Pt/c1-24(2)30-14-17-37(45)40-31(30)13-16-34(43-40)28-12-15-33-36(22-28)44(35-11-9-8-10-32(35)41(33,6)7)38-23-29(18-19-42-38)39-26(4)20-25(3)21-27(39)5;/h8-21,23-24,45H,1-7H3;/q-1; |
| InChIKey | CXTHUEFFWSYHJD-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.85 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|