C33H27F3N3OPt- — CID 171579886
2-[9,9-dimethyl-10-(4-propan-2-yl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(trifluoromethyl)quinolin-8-ol;platinum (PubChem CID 171579886) has the molecular formula C33H27F3N3OPt- and a molecular weight of 733.67 g/mol. Its IUPAC name is 2-[9,9-dimethyl-10-(4-propan-2-yl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(trifluoromethyl)quinolin-8-ol;platinum.
| Compound Name | 2-[9,9-dimethyl-10-(4-propan-2-yl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(trifluoromethyl)quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171579886 |
| Molecular Formula | C33H27F3N3OPt- |
| Molecular Weight | 733.67 g/mol |
| Exact Mass | 733.18 |
| IUPAC Name | 2-[9,9-dimethyl-10-(4-propan-2-yl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(trifluoromethyl)quinolin-8-ol;platinum |
| SMILES | CC(C)c1ccnc(N2c3[c-]c(-c4ccc5ccc(C(F)(F)F)c(O)c5n4)ccc3C(C)(C)c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C33H27F3N3O.Pt/c1-19(2)21-15-16-37-29(18-21)39-27-8-6-5-7-23(27)32(3,4)24-12-10-22(17-28(24)39)26-14-11-20-9-13-25(33(34,35)36)31(40)30(20)38-26;/h5-16,18-19,40H,1-4H3;/q-1; |
| InChIKey | PPGFLBHNSIQWMO-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|