C47H35N4OPt- — CID 171579988
2-[9,9-dimethyl-10-(4-phenyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(N-phenylanilino)quinolin-8-ol;platinum (PubChem CID 171579988) has the molecular formula C47H35N4OPt- and a molecular weight of 866.90 g/mol. Its IUPAC name is 2-[9,9-dimethyl-10-(4-phenyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(N-phenylanilino)quinolin-8-ol;platinum.
| Compound Name | 2-[9,9-dimethyl-10-(4-phenyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(N-phenylanilino)quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171579988 |
| Molecular Formula | C47H35N4OPt- |
| Molecular Weight | 866.90 g/mol |
| Exact Mass | 866.25 |
| IUPAC Name | 2-[9,9-dimethyl-10-(4-phenyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-7-(N-phenylanilino)quinolin-8-ol;platinum |
| SMILES | CC1(C)c2ccc(-c3ccc4ccc(N(c5ccccc5)c5ccccc5)c(O)c4n3)[c-]c2N(c2cc(-c3ccccc3)ccn2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C47H35N4O.Pt/c1-47(2)38-20-12-13-21-41(38)51(44-31-34(28-29-48-44)32-14-6-3-7-15-32)43-30-35(22-25-39(43)47)40-26-23-33-24-27-42(46(52)45(33)49-40)50(36-16-8-4-9-17-36)37-18-10-5-11-19-37;/h3-29,31,52H,1-2H3;/q-1; |
| InChIKey | HRJUGWYUWIGKLG-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.90 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|