C31H23F3N3OPt- — CID 171580331
2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-5-(trifluoromethyl)quinolin-8-ol;platinum (PubChem CID 171580331) has the molecular formula C31H23F3N3OPt- and a molecular weight of 705.62 g/mol. Its IUPAC name is 2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-5-(trifluoromethyl)quinolin-8-ol;platinum.
| Compound Name | 2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-5-(trifluoromethyl)quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171580331 |
| Molecular Formula | C31H23F3N3OPt- |
| Molecular Weight | 705.62 g/mol |
| Exact Mass | 705.14 |
| IUPAC Name | 2-[9,9-dimethyl-10-(4-methyl-2-pyridinyl)-4H-acridin-4-id-3-yl]-5-(trifluoromethyl)quinolin-8-ol;platinum |
| SMILES | Cc1ccnc(N2c3[c-]c(-c4ccc5c(C(F)(F)F)ccc(O)c5n4)ccc3C(C)(C)c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C31H23F3N3O.Pt/c1-18-14-15-35-28(16-18)37-25-7-5-4-6-22(25)30(2,3)23-10-8-19(17-26(23)37)24-12-9-20-21(31(32,33)34)11-13-27(38)29(20)36-24;/h4-16,38H,1-3H3;/q-1; |
| InChIKey | GMTHZAPJINTMGT-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.62 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|