C42H40N3OPt- — CID 171579713
7-(4-tert-butylphenyl)-2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-propan-2-ylquinolin-8-ol;platinum (PubChem CID 171579713) has the molecular formula C42H40N3OPt- and a molecular weight of 797.88 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-propan-2-ylquinolin-8-ol;platinum.
| Compound Name | 7-(4-tert-butylphenyl)-2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-propan-2-ylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171579713 |
| Molecular Formula | C42H40N3OPt- |
| Molecular Weight | 797.88 g/mol |
| Exact Mass | 797.28 |
| IUPAC Name | 7-(4-tert-butylphenyl)-2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-propan-2-ylquinolin-8-ol;platinum |
| SMILES | CC(C)c1cc(-c2ccc(C(C)(C)C)cc2)c(O)c2nc(-c3[c-]c4c(cc3)C(C)(C)c3ccccc3N4c3ccccn3)ccc12.[Pt] |
| InChI | InChI=1S/C42H40N3O.Pt/c1-26(2)31-25-32(27-15-18-29(19-16-27)41(3,4)5)40(46)39-30(31)20-22-35(44-39)28-17-21-34-37(24-28)45(38-14-10-11-23-43-38)36-13-9-8-12-33(36)42(34,6)7;/h8-23,25-26,46H,1-7H3;/q-1; |
| InChIKey | NDXYJPQOHIFZOZ-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.88 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|