C35H26N3OPt- — CID 171580341
2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-phenylquinolin-8-ol;platinum (PubChem CID 171580341) has the molecular formula C35H26N3OPt- and a molecular weight of 699.69 g/mol. Its IUPAC name is 2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-phenylquinolin-8-ol;platinum.
| Compound Name | 2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-phenylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171580341 |
| Molecular Formula | C35H26N3OPt- |
| Molecular Weight | 699.69 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | 2-(9,9-dimethyl-10-pyridin-2-yl-4H-acridin-4-id-3-yl)-5-phenylquinolin-8-ol;platinum |
| SMILES | CC1(C)c2ccc(-c3ccc4c(-c5ccccc5)ccc(O)c4n3)[c-]c2N(c2ccccn2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C35H26N3O.Pt/c1-35(2)27-12-6-7-13-30(27)38(33-14-8-9-21-36-33)31-22-24(15-18-28(31)35)29-19-16-26-25(23-10-4-3-5-11-23)17-20-32(39)34(26)37-29;/h3-21,39H,1-2H3;/q-1; |
| InChIKey | ZMPSFXSSEBBLAZ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.69 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|