About 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol
2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol (PubChem CID 171580342) has the molecular formula C35H27N3O
and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol.
Molecular Properties
| Compound Name | 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol |
| PubChem CID | 171580342 |
| Molecular Formula | C35H27N3O |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol |
| SMILES | CC1(C)c2ccccc2N(c2ccccn2)c2cc(-c3ccc4c(-c5ccccc5)ccc(O)c4n3)ccc21 |
| InChI | InChI=1S/C35H27N3O/c1-35(2)27-12-6-7-13-30(27)38(33-14-8-9-21-36-33)31-22-24(15-18-28(31)35)29-19-16-26-25(23-10-4-3-5-11-23)17-20-32(39)34(26)37-29/h3-22,39H,1-2H3 |
| InChIKey | HTHMUMSDGSRFTM-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol?
The IUPAC name of 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol (CID 171580342) is 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol.
What is the SMILES notation for 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol?
The canonical SMILES for 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol is CC1(C)c2ccccc2N(c2ccccn2)c2cc(-c3ccc4c(-c5ccccc5)ccc(O)c4n3)ccc21.
What is the InChIKey of 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol?
The InChIKey is HTHMUMSDGSRFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H27N3O/c1-35(2)27-12-6-7-13-30(27)38(33-14-8-9-21-36-33)31-22-24(15-18-28(31)35)29-19-16-26-25(23-10-4-3-5-11-23)17-20-32(39)34(26)37-29/h3-22,39H,1-2H3.
What are the key properties of 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol?
2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol has a molecular weight of 505.62 g/mol, XLogP of 8.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9,9-dimethyl-10-pyridin-2-ylacridin-3-yl)-5-phenylquinolin-8-ol is sourced from PubChem (CID 171580342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).