C40H37N4OPt- — CID 171579755
7-(dimethylamino)-2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]quinolin-8-ol;platinum (PubChem CID 171579755) has the molecular formula C40H37N4OPt- and a molecular weight of 784.84 g/mol. Its IUPAC name is 7-(dimethylamino)-2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]quinolin-8-ol;platinum.
| Compound Name | 7-(dimethylamino)-2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171579755 |
| Molecular Formula | C40H37N4OPt- |
| Molecular Weight | 784.84 g/mol |
| Exact Mass | 784.26 |
| IUPAC Name | 7-(dimethylamino)-2-[9,9-dimethyl-10-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-4H-acridin-4-id-3-yl]quinolin-8-ol;platinum |
| SMILES | Cc1cc(C)c(-c2ccnc(N3c4[c-]c(-c5ccc6ccc(N(C)C)c(O)c6n5)ccc4C(C)(C)c4ccccc43)c2)c(C)c1.[Pt] |
| InChI | InChI=1S/C40H37N4O.Pt/c1-24-20-25(2)37(26(3)21-24)29-18-19-41-36(23-29)44-33-11-9-8-10-30(33)40(4,5)31-15-12-28(22-35(31)44)32-16-13-27-14-17-34(43(6)7)39(45)38(27)42-32;/h8-21,23,45H,1-7H3;/q-1; |
| InChIKey | PYLGPEYSKQLADI-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.84 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|