C32H29N4OPt- — CID 171580161
7-ethyl-2-(5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum (PubChem CID 171580161) has the molecular formula C32H29N4OPt- and a molecular weight of 680.69 g/mol. Its IUPAC name is 7-ethyl-2-(5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum.
| Compound Name | 7-ethyl-2-(5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171580161 |
| Molecular Formula | C32H29N4OPt- |
| Molecular Weight | 680.69 g/mol |
| Exact Mass | 680.20 |
| IUPAC Name | 7-ethyl-2-(5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum |
| SMILES | CCc1cc(C(C)C)c2ccc(-c3[c-]c4c(cc3)N(C)c3ccccc3N4c3ccccn3)nc2c1O.[Pt] |
| InChI | InChI=1S/C32H29N4O.Pt/c1-5-21-18-24(20(2)3)23-14-15-25(34-31(23)32(21)37)22-13-16-27-29(19-22)36(30-12-8-9-17-33-30)28-11-7-6-10-26(28)35(27)4;/h6-18,20,37H,5H2,1-4H3;/q-1; |
| InChIKey | ZLPKZPFBLVWYNM-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.69 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|