C35H35N4OPt- — CID 171580321
2-(4-tert-butyl-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]quinolin-8-ol;platinum (PubChem CID 171580321) has the molecular formula C35H35N4OPt- and a molecular weight of 731.82 g/mol. Its IUPAC name is 2-(4-tert-butyl-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]quinolin-8-ol;platinum.
| Compound Name | 2-(4-tert-butyl-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171580321 |
| Molecular Formula | C35H35N4OPt- |
| Molecular Weight | 731.82 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | 2-(4-tert-butyl-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]quinolin-8-ol;platinum |
| SMILES | [2H]C([2H])([2H])C(c1ccc(O)c2nc(-c3[c-]c4c(c(C(C)(C)C)c3)N(C)c3ccccc3N4c3ccccn3)ccc12)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Pt] |
| InChI | InChI=1S/C35H35N4O.Pt/c1-34(2,3)24-16-18-30(40)32-23(24)15-17-26(37-32)22-20-25(35(4,5)6)33-29(21-22)39(31-14-10-11-19-36-31)28-13-9-8-12-27(28)38(33)7;/h8-20,40H,1-7H3;/q-1;/i1D3,2D3,3D3; |
| InChIKey | CLHNVDHRJRNGBZ-KYRNGWDOSA-N |
| XLogP | 8.95 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.82 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|