C31H24N5OPt- — CID 171580358
2-(8-isocyano-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum (PubChem CID 171580358) has the molecular formula C31H24N5OPt- and a molecular weight of 677.65 g/mol. Its IUPAC name is 2-(8-isocyano-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum.
| Compound Name | 2-(8-isocyano-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171580358 |
| Molecular Formula | C31H24N5OPt- |
| Molecular Weight | 677.65 g/mol |
| Exact Mass | 677.16 |
| IUPAC Name | 2-(8-isocyano-5-methyl-10-pyridin-2-yl-1H-phenazin-1-id-2-yl)-5-propan-2-ylquinolin-8-ol;platinum |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(c1ccccn1)c1[c-]c(-c3ccc4c(C(C)C)ccc(O)c4n3)ccc1N2C.[Pt] |
| InChI | InChI=1S/C31H24N5O.Pt/c1-19(2)22-11-15-29(37)31-23(22)10-12-24(34-31)20-8-13-25-27(17-20)36(30-7-5-6-16-33-30)28-18-21(32-3)9-14-26(28)35(25)4;/h5-16,18-19,37H,1-2,4H3;/q-1; |
| InChIKey | MQBTUZIBPLNSIO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 56.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.65 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|