C42H35N5O — CID 171580256
2-(5-methyl-10-pyridin-2-ylphenazin-2-yl)-7-(N-phenylanilino)-5-propan-2-ylquinolin-8-ol (PubChem CID 171580256) has the molecular formula C42H35N5O and a molecular weight of 625.78 g/mol. Its IUPAC name is 2-(5-methyl-10-pyridin-2-ylphenazin-2-yl)-7-(N-phenylanilino)-5-propan-2-ylquinolin-8-ol.
| Compound Name | 2-(5-methyl-10-pyridin-2-ylphenazin-2-yl)-7-(N-phenylanilino)-5-propan-2-ylquinolin-8-ol |
|---|---|
| PubChem CID | 171580256 |
| Molecular Formula | C42H35N5O |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 2-(5-methyl-10-pyridin-2-ylphenazin-2-yl)-7-(N-phenylanilino)-5-propan-2-ylquinolin-8-ol |
| SMILES | CC(C)c1cc(N(c2ccccc2)c2ccccc2)c(O)c2nc(-c3ccc4c(c3)N(c3ccccn3)c3ccccc3N4C)ccc12 |
| InChI | InChI=1S/C42H35N5O/c1-28(2)33-27-39(46(30-14-6-4-7-15-30)31-16-8-5-9-17-31)42(48)41-32(33)22-23-34(44-41)29-21-24-36-38(26-29)47(40-20-12-13-25-43-40)37-19-11-10-18-35(37)45(36)3/h4-28,48H,1-3H3 |
| InChIKey | OYRCMMPTNOETGX-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |