C35H32N4O — CID 171580210
5-tert-butyl-2-[1-isocyano-9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]quinolin-8-ol (PubChem CID 171580210) has the molecular formula C35H32N4O and a molecular weight of 524.67 g/mol. Its IUPAC name is 5-tert-butyl-2-[1-isocyano-9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]quinolin-8-ol.
| Compound Name | 5-tert-butyl-2-[1-isocyano-9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]quinolin-8-ol |
|---|---|
| PubChem CID | 171580210 |
| Molecular Formula | C35H32N4O |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 5-tert-butyl-2-[1-isocyano-9,9-dimethyl-10-(4-methyl-2-pyridinyl)acridin-3-yl]quinolin-8-ol |
| SMILES | [C-]#[N+]c1cc(-c2ccc3c(C(C)(C)C)ccc(O)c3n2)cc2c1C(C)(C)c1ccccc1N2c1cc(C)ccn1 |
| InChI | InChI=1S/C35H32N4O/c1-21-16-17-37-31(18-21)39-28-11-9-8-10-25(28)35(5,6)32-27(36-7)19-22(20-29(32)39)26-14-12-23-24(34(2,3)4)13-15-30(40)33(23)38-26/h8-20,40H,1-6H3 |
| InChIKey | FDAWPUIYFUXQDU-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 53.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|