C59H38N2O — CID 171583348
4-(9,9-diphenylfluoren-4-yl)-6-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-5-phenylphenyl]-2-phenylpyrimidine (PubChem CID 171583348) has the molecular formula C59H38N2O and a molecular weight of 798.01 g/mol. Its IUPAC name is 4-(9,9-diphenylfluoren-4-yl)-6-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-5-phenylphenyl]-2-phenylpyrimidine.
| Compound Name | 4-(9,9-diphenylfluoren-4-yl)-6-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-5-phenylphenyl]-2-phenylpyrimidine |
|---|---|
| PubChem CID | 171583348 |
| Molecular Formula | C59H38N2O |
| Molecular Weight | 798.01 g/mol |
| Exact Mass | 797.34 |
| IUPAC Name | 4-(9,9-diphenylfluoren-4-yl)-6-[3-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-5-phenylphenyl]-2-phenylpyrimidine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c(-c4cc(-c5ccccc5)cc(-c5cc(-c6cccc7c6-c6ccccc6C7(c6ccccc6)c6ccccc6)nc(-c6ccccc6)n5)c4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C59H38N2O/c1-5-18-39(19-6-1)42-34-43(41-32-33-56-50(37-41)47-26-14-16-31-55(47)62-56)36-44(35-42)53-38-54(61-58(60-53)40-20-7-2-8-21-40)49-28-17-30-52-57(49)48-27-13-15-29-51(48)59(52,45-22-9-3-10-23-45)46-24-11-4-12-25-46/h1-38H/i14D,16D,26D,31D,32D,33D,37D |
| InChIKey | PVZURCFLJGQUTR-GJKIMIQMSA-N |
| XLogP | 15.07 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.01 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |