C53H34N2O — CID 171602172
4-(9,9-diphenylfluoren-2-yl)-6-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)phenyl]-2-phenylpyrimidine (PubChem CID 171602172) has the molecular formula C53H34N2O and a molecular weight of 721.91 g/mol. Its IUPAC name is 4-(9,9-diphenylfluoren-2-yl)-6-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)phenyl]-2-phenylpyrimidine.
| Compound Name | 4-(9,9-diphenylfluoren-2-yl)-6-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)phenyl]-2-phenylpyrimidine |
|---|---|
| PubChem CID | 171602172 |
| Molecular Formula | C53H34N2O |
| Molecular Weight | 721.91 g/mol |
| Exact Mass | 721.31 |
| IUPAC Name | 4-(9,9-diphenylfluoren-2-yl)-6-[4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)phenyl]-2-phenylpyrimidine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c(-c4ccc(-c5cc(-c6ccc7c(c6)C(c6ccccc6)(c6ccccc6)c6ccccc6-7)nc(-c6ccccc6)n5)cc4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C53H34N2O/c1-4-14-37(15-5-1)52-54-48(36-26-24-35(25-27-36)38-29-31-51-45(32-38)44-21-11-13-23-50(44)56-51)34-49(55-52)39-28-30-43-42-20-10-12-22-46(42)53(47(43)33-39,40-16-6-2-7-17-40)41-18-8-3-9-19-41/h1-34H/i11D,13D,21D,23D,29D,31D,32D |
| InChIKey | XWGPKDZIEJFDJX-QSFVNHEFSA-N |
| XLogP | 13.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.91 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |