C47H29N3O — CID 171584105
3-[6-[3-dibenzofuran-2-yl-5-(4-phenylphenyl)phenyl]-2-phenylpyrimidin-4-yl]benzonitrile (PubChem CID 171584105) has the molecular formula C47H29N3O and a molecular weight of 651.77 g/mol. Its IUPAC name is 3-[6-[3-dibenzofuran-2-yl-5-(4-phenylphenyl)phenyl]-2-phenylpyrimidin-4-yl]benzonitrile.
| Compound Name | 3-[6-[3-dibenzofuran-2-yl-5-(4-phenylphenyl)phenyl]-2-phenylpyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 171584105 |
| Molecular Formula | C47H29N3O |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | 3-[6-[3-dibenzofuran-2-yl-5-(4-phenylphenyl)phenyl]-2-phenylpyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3cc(-c4ccc(-c5ccccc5)cc4)cc(-c4ccc5oc6ccccc6c5c4)c3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C47H29N3O/c48-30-31-10-9-15-37(24-31)43-29-44(50-47(49-43)35-13-5-2-6-14-35)40-26-38(34-20-18-33(19-21-34)32-11-3-1-4-12-32)25-39(27-40)36-22-23-46-42(28-36)41-16-7-8-17-45(41)51-46/h1-29H |
| InChIKey | JRCUICGBNZCOQJ-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |