C24H48N4O5 — CID 171587024
N-[4-[[(2E)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]butyl]-2,2-dimethylpropanamide (PubChem CID 171587024) has the molecular formula C24H48N4O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is N-[4-[[(2E)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]butyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[(2E)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]butyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 171587024 |
| Molecular Formula | C24H48N4O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | N-[4-[[(2E)-3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]butyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)CCOCCOCCOCCOCC(/C=N/CCCCNC(=O)C(C)(C)C)=N/N |
| InChI | InChI=1S/C24H48N4O5/c1-23(2,3)9-12-30-13-14-31-15-16-32-17-18-33-20-21(28-25)19-26-10-7-8-11-27-22(29)24(4,5)6/h19H,7-18,20,25H2,1-6H3,(H,27,29)/b26-19+,28-21+ |
| InChIKey | YWDJQHRYABGELC-VRNZAQLISA-N |
| XLogP | 2.82 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|