C18H35N3O6 — CID 164540751
4-[2-[2-[[(2E)-2-hydrazinylidene-3-[2-(2-hydroxypentoxy)ethoxy]propylidene]amino]ethoxy]ethoxy]butan-2-one (PubChem CID 164540751) has the molecular formula C18H35N3O6 and a molecular weight of 389.49 g/mol. Its IUPAC name is 4-[2-[2-[[(2E)-2-hydrazinylidene-3-[2-(2-hydroxypentoxy)ethoxy]propylidene]amino]ethoxy]ethoxy]butan-2-one.
| Compound Name | 4-[2-[2-[[(2E)-2-hydrazinylidene-3-[2-(2-hydroxypentoxy)ethoxy]propylidene]amino]ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 164540751 |
| Molecular Formula | C18H35N3O6 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 4-[2-[2-[[(2E)-2-hydrazinylidene-3-[2-(2-hydroxypentoxy)ethoxy]propylidene]amino]ethoxy]ethoxy]butan-2-one |
| SMILES | CCCC(O)COCCOCC(/C=N/CCOCCOCCC(C)=O)=N/N |
| InChI | InChI=1S/C18H35N3O6/c1-3-4-18(23)15-27-12-11-26-14-17(21-19)13-20-6-8-25-10-9-24-7-5-16(2)22/h13,18,23H,3-12,14-15,19H2,1-2H3/b20-13+,21-17+ |
| InChIKey | XMHBAFOEFYHUHH-YHHVCGRHSA-N |
| XLogP | 0.58 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|