C24H49N5O4 — CID 166558266
ethane;(Z)-3-[6-[[(2E)-2-hydrazinylidene-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propylidene]amino]hexylimino]-2-methylprop-1-en-1-amine (PubChem CID 166558266) has the molecular formula C24H49N5O4 and a molecular weight of 471.69 g/mol. Its IUPAC name is ethane;(Z)-3-[6-[[(2E)-2-hydrazinylidene-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propylidene]amino]hexylimino]-2-methylprop-1-en-1-amine.
| Compound Name | ethane;(Z)-3-[6-[[(2E)-2-hydrazinylidene-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propylidene]amino]hexylimino]-2-methylprop-1-en-1-amine |
|---|---|
| PubChem CID | 166558266 |
| Molecular Formula | C24H49N5O4 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.38 |
| IUPAC Name | ethane;(Z)-3-[6-[[(2E)-2-hydrazinylidene-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propylidene]amino]hexylimino]-2-methylprop-1-en-1-amine |
| SMILES | CC.CCCOCCOCCOCCOCC(/C=N/CCCCCC/N=C/C(C)=C\N)=N/N |
| InChI | InChI=1S/C22H43N5O4.C2H6/c1-3-10-28-11-12-29-13-14-30-15-16-31-20-22(27-24)19-26-9-7-5-4-6-8-25-18-21(2)17-23;1-2/h17-19H,3-16,20,23-24H2,1-2H3;1-2H3/b21-17-,25-18+,26-19+,27-22+; |
| InChIKey | YTERQPYIIVDHTL-UZSQYWQJSA-N |
| XLogP | 3.37 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|