C28H45F3N4O10 — CID 170718887
(2,4,6-trifluorophenyl) 3-[2-[2-[2-[2-[[(2E)-3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 170718887) has the molecular formula C28H45F3N4O10 and a molecular weight of 654.68 g/mol. Its IUPAC name is (2,4,6-trifluorophenyl) 3-[2-[2-[2-[2-[[(2E)-3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,4,6-trifluorophenyl) 3-[2-[2-[2-[2-[[(2E)-3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 170718887 |
| Molecular Formula | C28H45F3N4O10 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | (2,4,6-trifluorophenyl) 3-[2-[2-[2-[2-[[(2E)-3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | NCCOCCOCCOCCOCC(/C=N/CCOCCOCCOCCOCCC(=O)Oc1c(F)cc(F)cc1F)=N/N |
| InChI | InChI=1S/C28H45F3N4O10/c29-23-19-25(30)28(26(31)20-23)45-27(36)1-4-37-7-10-40-13-14-42-12-9-39-6-3-34-21-24(35-33)22-44-18-17-43-16-15-41-11-8-38-5-2-32/h19-21H,1-18,22,32-33H2/b34-21+,35-24+ |
| InChIKey | UZBQHNQDHRFQJT-UTSBQEPASA-N |
| XLogP | 0.88 |
| TPSA | 176.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|