C24H26F5N5O4S — CID 166479267
(2,3,4,5,6-pentafluorophenyl) 3-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]propanoate (PubChem CID 166479267) has the molecular formula C24H26F5N5O4S and a molecular weight of 575.56 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]propanoate |
|---|---|
| PubChem CID | 166479267 |
| Molecular Formula | C24H26F5N5O4S |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]propanoate |
| SMILES | N/N=C(\C=N\CCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)CCCCNC(=S)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C24H26F5N5O4S/c25-18-19(26)21(28)23(22(29)20(18)27)38-17(36)8-11-37-12-10-31-13-15(34-30)3-1-2-9-32-24(39)33-14-4-6-16(35)7-5-14/h4-7,13,35H,1-3,8-12,30H2,(H2,32,33,39)/b31-13+,34-15- |
| InChIKey | HNHCWECHHFESQS-XMPHIXFESA-N |
| XLogP | 3.94 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|