C10H15N3OS — CID 87650524
1-(3-aminopropyl)-3-(4-hydroxyphenyl)thiourea (PubChem CID 87650524) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-(4-hydroxyphenyl)thiourea.
| Compound Name | 1-(3-aminopropyl)-3-(4-hydroxyphenyl)thiourea |
|---|---|
| PubChem CID | 87650524 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-(3-aminopropyl)-3-(4-hydroxyphenyl)thiourea |
| SMILES | NCCCNC(=S)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C10H15N3OS/c11-6-1-7-12-10(15)13-8-2-4-9(14)5-3-8/h2-5,14H,1,6-7,11H2,(H2,12,13,15) |
| InChIKey | XXROQFJRFKEOFR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|