C22H29F5N4O10 — CID 174034286
(2,3,4,5,6-pentafluorophenyl) 3-[2-[[4-[(2S,5S)-6-[2-(dihydroxyamino)ethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-hydrazinylidenebutylidene]amino]ethoxy]propanoate (PubChem CID 174034286) has the molecular formula C22H29F5N4O10 and a molecular weight of 604.48 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[[4-[(2S,5S)-6-[2-(dihydroxyamino)ethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-hydrazinylidenebutylidene]amino]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[[4-[(2S,5S)-6-[2-(dihydroxyamino)ethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-hydrazinylidenebutylidene]amino]ethoxy]propanoate |
|---|---|
| PubChem CID | 174034286 |
| Molecular Formula | C22H29F5N4O10 |
| Molecular Weight | 604.48 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[[4-[(2S,5S)-6-[2-(dihydroxyamino)ethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-hydrazinylidenebutylidene]amino]ethoxy]propanoate |
| SMILES | NN=C(/C=N/CCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)CCO[C@H]1OC(CCN(O)O)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C22H29F5N4O10/c23-13-14(24)16(26)21(17(27)15(13)25)41-12(32)3-6-38-8-4-29-9-10(30-28)2-7-39-22-20(35)19(34)18(33)11(40-22)1-5-31(36)37/h9,11,18-20,22,33-37H,1-8,28H2/b29-9+,30-10?/t11?,18-,19?,20?,22+/m1/s1 |
| InChIKey | XJFUWCALAGLONN-JXNDOCSASA-N |
| XLogP | -0.24 |
| TPSA | 209.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.48 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|