C33H43F4N5O7S — CID 174034287
(2,3,4,6-tetrafluoro-5-prop-1-en-2-ylphenyl) 3-[2-[2-[2-[2-[[2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 174034287) has the molecular formula C33H43F4N5O7S and a molecular weight of 729.79 g/mol. Its IUPAC name is (2,3,4,6-tetrafluoro-5-prop-1-en-2-ylphenyl) 3-[2-[2-[2-[2-[[2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,6-tetrafluoro-5-prop-1-en-2-ylphenyl) 3-[2-[2-[2-[2-[[2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 174034287 |
| Molecular Formula | C33H43F4N5O7S |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.28 |
| IUPAC Name | (2,3,4,6-tetrafluoro-5-prop-1-en-2-ylphenyl) 3-[2-[2-[2-[2-[[2-hydrazinylidene-6-[(4-hydroxyphenyl)carbamothioylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | C=C(C)c1c(F)c(F)c(F)c(OC(=O)CCOCCOCCOCCOCC/N=C/C(CCCCNC(=S)Nc2ccc(O)cc2)=NN)c1F |
| InChI | InChI=1S/C33H43F4N5O7S/c1-22(2)27-28(34)30(36)31(37)32(29(27)35)49-26(44)10-13-45-15-17-47-19-20-48-18-16-46-14-12-39-21-24(42-38)5-3-4-11-40-33(50)41-23-6-8-25(43)9-7-23/h6-9,21,43H,1,3-5,10-20,38H2,2H3,(H2,40,41,50)/b39-21+,42-24? |
| InChIKey | NBSHZRDIRUSDDM-IXHOAXPHSA-N |
| XLogP | 4.89 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|