C31H40F5N5O8 — CID 166478997
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxy-3-methylphenyl)carbamoylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 166478997) has the molecular formula C31H40F5N5O8 and a molecular weight of 705.68 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxy-3-methylphenyl)carbamoylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxy-3-methylphenyl)carbamoylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 166478997 |
| Molecular Formula | C31H40F5N5O8 |
| Molecular Weight | 705.68 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[[(2Z)-2-hydrazinylidene-6-[(4-hydroxy-3-methylphenyl)carbamoylamino]hexylidene]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | Cc1cc(NC(=O)NCCCCC(/C=N/CCOCCOCCOCCOCCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)=N/N)ccc1O |
| InChI | InChI=1S/C31H40F5N5O8/c1-20-18-21(5-6-23(20)42)40-31(44)39-8-3-2-4-22(41-37)19-38-9-11-46-13-15-48-17-16-47-14-12-45-10-7-24(43)49-30-28(35)26(33)25(32)27(34)29(30)36/h5-6,18-19,42H,2-4,7-17,37H2,1H3,(H2,39,40,44)/b38-19+,41-22- |
| InChIKey | HMACBFMLGIAGRB-LVSDGVKLSA-N |
| XLogP | 4.14 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|