C17H39InN2 — CID 171588607
N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methylpropan-1-amine (PubChem CID 171588607) has the molecular formula C17H39InN2 and a molecular weight of 386.33 g/mol. Its IUPAC name is N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methylpropan-1-amine.
| Compound Name | N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 171588607 |
| Molecular Formula | C17H39InN2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methylpropan-1-amine |
| SMILES | CCC[In](CCCN(C)CC)CCCN(CC)C(C)C |
| InChI | InChI=1S/C8H18N.C6H14N.C3H7.In/c1-5-7-9(6-2)8(3)4;1-4-6-7(3)5-2;1-3-2;/h8H,1,5-7H2,2-4H3;1,4-6H2,2-3H3;1,3H2,2H3; |
| InChIKey | QFNWYRLODZSAQL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |