C19H43InN2 — CID 171588524
N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-propylpropan-1-amine (PubChem CID 171588524) has the molecular formula C19H43InN2 and a molecular weight of 414.39 g/mol. Its IUPAC name is N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-propylpropan-1-amine.
| Compound Name | N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 171588524 |
| Molecular Formula | C19H43InN2 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-ethyl-3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CC)CCC[In](CCC)CCCN(CC)C(C)C |
| InChI | InChI=1S/2C8H18N.C3H7.In/c1-5-7-9(6-2)8(3)4;1-4-7-9(6-3)8-5-2;1-3-2;/h8H,1,5-7H2,2-4H3;1,4-8H2,2-3H3;1,3H2,2H3; |
| InChIKey | LADNNJAFWZCBOT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |