C18H41InN2 — CID 171588667
3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methyl-N-propylpropan-1-amine (PubChem CID 171588667) has the molecular formula C18H41InN2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methyl-N-propylpropan-1-amine.
| Compound Name | 3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 171588667 |
| Molecular Formula | C18H41InN2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3-[3-[ethyl(propan-2-yl)amino]propyl-propylindiganyl]-N-methyl-N-propylpropan-1-amine |
| SMILES | CCCN(C)CCC[In](CCC)CCCN(CC)C(C)C |
| InChI | InChI=1S/C8H18N.C7H16N.C3H7.In/c1-5-7-9(6-2)8(3)4;1-4-6-8(3)7-5-2;1-3-2;/h8H,1,5-7H2,2-4H3;1,4-7H2,2-3H3;1,3H2,2H3; |
| InChIKey | QIRMYKVZORGACN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |