C20H22F3IN2OSi — CID 171590383
2-[[4-iodo-6-[4-(trifluoromethyl)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171590383) has the molecular formula C20H22F3IN2OSi and a molecular weight of 518.39 g/mol. Its IUPAC name is 2-[[4-iodo-6-[4-(trifluoromethyl)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-iodo-6-[4-(trifluoromethyl)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171590383 |
| Molecular Formula | C20H22F3IN2OSi |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 2-[[4-iodo-6-[4-(trifluoromethyl)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(I)cc(-c3ccc(C(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C20H22F3IN2OSi/c1-28(2,3)9-8-27-13-26-19-11-15(10-18(24)17(19)12-25-26)14-4-6-16(7-5-14)20(21,22)23/h4-7,10-12H,8-9,13H2,1-3H3 |
| InChIKey | MSPTVNISNXUDED-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|