C18H25NO3 — CID 171593267
[3-(hydroxymethyl)indol-1-yl]methyl octanoate (PubChem CID 171593267) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [3-(hydroxymethyl)indol-1-yl]methyl octanoate.
| Compound Name | [3-(hydroxymethyl)indol-1-yl]methyl octanoate |
|---|---|
| PubChem CID | 171593267 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [3-(hydroxymethyl)indol-1-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCn1cc(CO)c2ccccc21 |
| InChI | InChI=1S/C18H25NO3/c1-2-3-4-5-6-11-18(21)22-14-19-12-15(13-20)16-9-7-8-10-17(16)19/h7-10,12,20H,2-6,11,13-14H2,1H3 |
| InChIKey | YLPFUESAPXWAOO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|