C15H12F3N3 — CID 171594927
N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-amine (PubChem CID 171594927) has the molecular formula C15H12F3N3 and a molecular weight of 291.28 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-amine.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 171594927 |
| Molecular Formula | C15H12F3N3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indazol-3-amine |
| SMILES | FC(F)(F)c1ccc(CNc2n[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C15H12F3N3/c16-15(17,18)11-7-5-10(6-8-11)9-19-14-12-3-1-2-4-13(12)20-21-14/h1-8H,9H2,(H2,19,20,21) |
| InChIKey | TUHROURFNLPVIL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |