C22H15BrF3N3 — CID 46086055
2-(3-bromophenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 46086055) has the molecular formula C22H15BrF3N3 and a molecular weight of 458.28 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 2-(3-bromophenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 46086055 |
| Molecular Formula | C22H15BrF3N3 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 2-(3-bromophenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1ccc(CNc2nc(-c3cccc(Br)c3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H15BrF3N3/c23-17-5-3-4-15(12-17)20-28-19-7-2-1-6-18(19)21(29-20)27-13-14-8-10-16(11-9-14)22(24,25)26/h1-12H,13H2,(H,27,28,29) |
| InChIKey | QZMMWQMTANKXCH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |