C58H47N5OPt-2 — CID 171596058
CID 171596058 (PubChem CID 171596058) has the molecular formula C58H47N5OPt-2 and a molecular weight of 1028.14 g/mol.
| Compound Name | CID 171596058 |
|---|---|
| PubChem CID | 171596058 |
| Molecular Formula | C58H47N5OPt-2 |
| Molecular Weight | 1028.14 g/mol |
| Exact Mass | 1027.36 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc(-n2c(=[Pt])n(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccccc32)[c-]c1Oc1[c-]c2c(cc1)c1cc3c4cccc5c6ccccc6n(c3cc1n2-c1cc(C)ccn1)c54 |
| InChI | InChI=1S/C58H47N5O.Pt/c1-35-24-25-59-55(26-35)62-51-31-41(22-23-43(51)46-32-47-45-16-13-15-44-42-14-9-10-17-48(42)63(56(44)45)53(47)33-52(46)62)64-54-30-39(21-20-36(54)2)60-34-61(50-19-12-11-18-49(50)60)40-28-37(57(3,4)5)27-38(29-40)58(6,7)8;/h9-29,32-33H,1-8H3;/q-2;/i2D3; |
| InChIKey | AQDQKFVMDKMSRK-MUTAZJQDSA-N |
| XLogP | 14.75 |
| TPSA | 41.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.14 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|