C76H67N5OPt-2 — CID 171595982
CID 171595982 (PubChem CID 171595982) has the molecular formula C76H67N5OPt-2 and a molecular weight of 1261.48 g/mol.
| Compound Name | CID 171595982 |
|---|---|
| PubChem CID | 171595982 |
| Molecular Formula | C76H67N5OPt-2 |
| Molecular Weight | 1261.48 g/mol |
| Exact Mass | 1260.50 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(Oc2[c-]c3c(cc2)c2cc4c5cccc6c7ccccc7n(c4cc2n3-c2cc(C(C)(C)C)ccn2)c65)[c-]c(-n2c(=[Pt])n(-c3c(-c4ccccc4)cccc3-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C76H67N5O.Pt/c1-73(2,3)49-34-35-77-70(41-49)80-67-43-54(32-33-59(67)62-44-63-61-28-21-27-60-58-24-16-17-29-64(58)81(72(60)61)69(63)45-68(62)80)82-55-40-52(76(10,11)12)39-53(42-55)78-46-79(66-31-19-18-30-65(66)78)71-56(47-22-14-13-15-23-47)25-20-26-57(71)48-36-50(74(4,5)6)38-51(37-48)75(7,8)9;/h13-41,44-45H,1-12H3;/q-2; |
| InChIKey | DUAWTQBARBMBIH-UHFFFAOYSA-N |
| XLogP | 20.06 |
| TPSA | 41.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1261.48 |
| LogP ≤ 5 | 20.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|