About CID 171596111
CID 171596111 (PubChem CID 171596111) has the molecular formula C62H39N5OPt-2
and a molecular weight of 1065.11 g/mol.
Molecular Properties
| Compound Name | CID 171596111 |
| PubChem CID | 171596111 |
| Molecular Formula | C62H39N5OPt-2 |
| Molecular Weight | 1065.11 g/mol |
| Exact Mass | 1064.28 |
| IUPAC Name | — |
| SMILES | Cc1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5c(=[Pt])n(-c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)ccc4C)ccc3c3cc4c5cccc6c7ccccc7n(c4cc32)c65)c1 |
| InChI | InChI=1S/C62H39N5O.Pt/c1-39-31-32-63-60(33-39)66-56-35-44(29-30-48(56)51-36-52-50-23-14-22-49-47-19-9-10-24-53(47)67(62(49)50)58(52)37-57(51)66)68-59-34-43(28-27-40(59)2)64-38-65(55-26-12-11-25-54(55)64)61-45(41-15-5-3-6-16-41)20-13-21-46(61)42-17-7-4-8-18-42;/h3-33,36-37H,1-2H3;/q-2; |
| InChIKey | OFNWYFLQZZRERS-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 41.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1065.11 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 171596111 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171596111?
The IUPAC name of CID 171596111 (CID 171596111) is not available.
What is the SMILES notation for CID 171596111?
The canonical SMILES for CID 171596111 is Cc1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5c(=[Pt])n(-c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)ccc4C)ccc3c3cc4c5cccc6c7ccccc7n(c4cc32)c65)c1.
What is the InChIKey of CID 171596111?
The InChIKey is OFNWYFLQZZRERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C62H39N5O.Pt/c1-39-31-32-63-60(33-39)66-56-35-44(29-30-48(56)51-36-52-50-23-14-22-49-47-19-9-10-24-53(47)67(62(49)50)58(52)37-57(51)66)68-59-34-43(28-27-40(59)2)64-38-65(55-26-12-11-25-54(55)64)61-45(41-15-5-3-6-16-41)20-13-21-46(61)42-17-7-4-8-18-42;/h3-33,36-37H,1-2H3;/q-2;.
What are the key properties of CID 171596111?
CID 171596111 has a molecular weight of 1065.11 g/mol, XLogP of 15.49, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171596111 is sourced from PubChem (CID 171596111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).