C25H38N8O2 — CID 171599051
4-N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-d]pyrimidin-6-ylmethyl)-2-N-[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 171599051) has the molecular formula C25H38N8O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 4-N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-d]pyrimidin-6-ylmethyl)-2-N-[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-d]pyrimidin-6-ylmethyl)-2-N-[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171599051 |
| Molecular Formula | C25H38N8O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 4-N-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-d]pyrimidin-6-ylmethyl)-2-N-[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nccc(NCN3CC4CNCNC4C3)n2)cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H38N8O2/c1-34-22-6-5-20(13-23(22)35-12-4-11-32-9-2-3-10-32)30-25-27-8-7-24(31-25)29-18-33-15-19-14-26-17-28-21(19)16-33/h5-8,13,19,21,26,28H,2-4,9-12,14-18H2,1H3,(H2,27,29,30,31) |
| InChIKey | JQOSNBZVKCFSOE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|