C27H32N6O3 — CID 146554173
2-N-[4-hydroperoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-4-N-[2-(1H-indol-2-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 146554173) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-N-[4-hydroperoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-4-N-[2-(1H-indol-2-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-hydroperoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-4-N-[2-(1H-indol-2-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 146554173 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-N-[4-hydroperoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]-4-N-[2-(1H-indol-2-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | OOc1ccc(Nc2nccc(NCCc3cc4ccccc4[nH]3)n2)cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C27H32N6O3/c34-36-24-9-8-21(19-25(24)35-17-5-16-33-14-3-4-15-33)31-27-29-13-11-26(32-27)28-12-10-22-18-20-6-1-2-7-23(20)30-22/h1-2,6-9,11,13,18-19,30,34H,3-5,10,12,14-17H2,(H2,28,29,31,32) |
| InChIKey | DIGOMSOMBJEHMI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|