C17H17Cl2NO2 — CID 17160527
N-(4-butan-2-yloxyphenyl)-2,4-dichlorobenzamide (PubChem CID 17160527) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is N-(4-butan-2-yloxyphenyl)-2,4-dichlorobenzamide.
| Compound Name | N-(4-butan-2-yloxyphenyl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 17160527 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(4-butan-2-yloxyphenyl)-2,4-dichlorobenzamide |
| SMILES | CCC(C)Oc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-3-11(2)22-14-7-5-13(6-8-14)20-17(21)15-9-4-12(18)10-16(15)19/h4-11H,3H2,1-2H3,(H,20,21) |
| InChIKey | LVPLKMCDMRPZQB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |