C29H14N8 — CID 171607192
9-[2,4-bis(5-cyanopyrimidin-2-yl)phenyl]carbazole-3-carbonitrile (PubChem CID 171607192) has the molecular formula C29H14N8 and a molecular weight of 474.49 g/mol. Its IUPAC name is 9-[2,4-bis(5-cyanopyrimidin-2-yl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[2,4-bis(5-cyanopyrimidin-2-yl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 171607192 |
| Molecular Formula | C29H14N8 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 9-[2,4-bis(5-cyanopyrimidin-2-yl)phenyl]carbazole-3-carbonitrile |
| SMILES | N#Cc1cnc(-c2ccc(-n3c4ccccc4c4cc(C#N)ccc43)c(-c3ncc(C#N)cn3)c2)nc1 |
| InChI | InChI=1S/C29H14N8/c30-11-18-5-7-26-23(9-18)22-3-1-2-4-25(22)37(26)27-8-6-21(28-33-14-19(12-31)15-34-28)10-24(27)29-35-16-20(13-32)17-36-29/h1-10,14-17H |
| InChIKey | PJWJMFRJSLAQRF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 127.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |