C27H35FN4O4 — CID 171618452
N-[4-[[1-(4-fluorophenyl)cyclohexyl]carbamoylamino]-7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 171618452) has the molecular formula C27H35FN4O4 and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[4-[[1-(4-fluorophenyl)cyclohexyl]carbamoylamino]-7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | N-[4-[[1-(4-fluorophenyl)cyclohexyl]carbamoylamino]-7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 171618452 |
| Molecular Formula | C27H35FN4O4 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-[4-[[1-(4-fluorophenyl)cyclohexyl]carbamoylamino]-7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | O=C(CCC(CCCNC(=O)c1ccccc1)NC(=O)NC1(c2ccc(F)cc2)CCCCC1)NO |
| InChI | InChI=1S/C27H35FN4O4/c28-22-13-11-21(12-14-22)27(17-5-2-6-18-27)31-26(35)30-23(15-16-24(33)32-36)10-7-19-29-25(34)20-8-3-1-4-9-20/h1,3-4,8-9,11-14,23,36H,2,5-7,10,15-19H2,(H,29,34)(H,32,33)(H2,30,31,35) |
| InChIKey | FGSVDPXDMIWKQQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|