C24H24F7NO — CID 171619704
5-[[2,4-difluoro-6-(1-fluoropropyl)phenyl]methyl]-3a-fluoro-2,8-dimethyl-4,8b-dihydroindeno[2,1-d][1,3]oxazole;1,1,1-trifluoroethane (PubChem CID 171619704) has the molecular formula C24H24F7NO and a molecular weight of 475.45 g/mol. Its IUPAC name is 5-[[2,4-difluoro-6-(1-fluoropropyl)phenyl]methyl]-3a-fluoro-2,8-dimethyl-4,8b-dihydroindeno[2,1-d][1,3]oxazole;1,1,1-trifluoroethane.
| Compound Name | 5-[[2,4-difluoro-6-(1-fluoropropyl)phenyl]methyl]-3a-fluoro-2,8-dimethyl-4,8b-dihydroindeno[2,1-d][1,3]oxazole;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 171619704 |
| Molecular Formula | C24H24F7NO |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 5-[[2,4-difluoro-6-(1-fluoropropyl)phenyl]methyl]-3a-fluoro-2,8-dimethyl-4,8b-dihydroindeno[2,1-d][1,3]oxazole;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CCC(F)c1cc(F)cc(F)c1Cc1ccc(C)c2c1CC1(F)N=C(C)OC21 |
| InChI | InChI=1S/C22H21F4NO.C2H3F3/c1-4-18(24)16-8-14(23)9-19(25)15(16)7-13-6-5-11(2)20-17(13)10-22(26)21(20)28-12(3)27-22;1-2(3,4)5/h5-6,8-9,18,21H,4,7,10H2,1-3H3;1H3 |
| InChIKey | BEVJOGDYQYAMHM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|