C22H19F4NO — CID 171619836
[4-(6,8-difluoro-3,4-dihydronaphthalen-1-yl)-2,2-difluoro-7-methyl-1,3-dihydroinden-1-yl] ethanimidate (PubChem CID 171619836) has the molecular formula C22H19F4NO and a molecular weight of 389.39 g/mol. Its IUPAC name is [4-(6,8-difluoro-3,4-dihydronaphthalen-1-yl)-2,2-difluoro-7-methyl-1,3-dihydroinden-1-yl] ethanimidate.
| Compound Name | [4-(6,8-difluoro-3,4-dihydronaphthalen-1-yl)-2,2-difluoro-7-methyl-1,3-dihydroinden-1-yl] ethanimidate |
|---|---|
| PubChem CID | 171619836 |
| Molecular Formula | C22H19F4NO |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [4-(6,8-difluoro-3,4-dihydronaphthalen-1-yl)-2,2-difluoro-7-methyl-1,3-dihydroinden-1-yl] ethanimidate |
| SMILES | [H]/N=C(\C)OC1c2c(C)ccc(C3=CCCc4cc(F)cc(F)c43)c2CC1(F)F |
| InChI | InChI=1S/C22H19F4NO/c1-11-6-7-15(17-10-22(25,26)21(19(11)17)28-12(2)27)16-5-3-4-13-8-14(23)9-18(24)20(13)16/h5-9,21,27H,3-4,10H2,1-2H3/b27-12+ |
| InChIKey | IGXUWVOVVZOMDZ-KKMKTNMSSA-N |
| XLogP | 5.90 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|