C25H19F4NO — CID 59069404
(4R,5S)-4-[4-(2,2-difluoro-1,3-dihydroinden-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 59069404) has the molecular formula C25H19F4NO and a molecular weight of 425.43 g/mol. Its IUPAC name is (4R,5S)-4-[4-(2,2-difluoro-1,3-dihydroinden-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5S)-4-[4-(2,2-difluoro-1,3-dihydroinden-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 59069404 |
| Molecular Formula | C25H19F4NO |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (4R,5S)-4-[4-(2,2-difluoro-1,3-dihydroinden-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@@H]1OC(c2c(F)cccc2F)=N[C@@H]1c1ccc(-c2ccc3c(c2)CC(F)(F)C3)cc1 |
| InChI | InChI=1S/C25H19F4NO/c1-14-23(30-24(31-14)22-20(26)3-2-4-21(22)27)16-7-5-15(6-8-16)17-9-10-18-12-25(28,29)13-19(18)11-17/h2-11,14,23H,12-13H2,1H3/t14-,23-/m0/s1 |
| InChIKey | HPVWWOWERZYHNB-PSLXWICFSA-N |
| XLogP | 6.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |