C31H36 — CID 171619883
7-[4-(4,4-dimethylcyclohepta-1,6-dien-1-yl)cyclohepta-3,5-dien-1-yl]-7-methyl-3-(4-methylphenyl)cyclohepta-1,3,5-triene (PubChem CID 171619883) has the molecular formula C31H36 and a molecular weight of 408.63 g/mol. Its IUPAC name is 7-[4-(4,4-dimethylcyclohepta-1,6-dien-1-yl)cyclohepta-3,5-dien-1-yl]-7-methyl-3-(4-methylphenyl)cyclohepta-1,3,5-triene.
| Compound Name | 7-[4-(4,4-dimethylcyclohepta-1,6-dien-1-yl)cyclohepta-3,5-dien-1-yl]-7-methyl-3-(4-methylphenyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 171619883 |
| Molecular Formula | C31H36 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 7-[4-(4,4-dimethylcyclohepta-1,6-dien-1-yl)cyclohepta-3,5-dien-1-yl]-7-methyl-3-(4-methylphenyl)cyclohepta-1,3,5-triene |
| SMILES | Cc1ccc(C2=CC=CC(C)(C3CC=CC(C4=CCC(C)(C)CC=C4)=CC3)C=C2)cc1 |
| InChI | InChI=1S/C31H36/c1-24-12-14-28(15-13-24)27-10-7-21-31(4,23-19-27)29-11-5-8-25(16-17-29)26-9-6-20-30(2,3)22-18-26/h5-10,12-16,18-19,21,23,29H,11,17,20,22H2,1-4H3 |
| InChIKey | RCAJEWIEWKEILU-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |