About 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole
2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole (PubChem CID 90816110) has the molecular formula C21H19NO
and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole |
| PubChem CID | 90816110 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole |
| SMILES | Cc1ccc(C2=CCC(C)(c3nc4ccccc4o3)C=C2)cc1 |
| InChI | InChI=1S/C21H19NO/c1-15-7-9-16(10-8-15)17-11-13-21(2,14-12-17)20-22-18-5-3-4-6-19(18)23-20/h3-13H,14H2,1-2H3 |
| InChIKey | ATCINQQGHSVFLJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole?
The IUPAC name of 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole (CID 90816110) is 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole.
What is the SMILES notation for 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole?
The canonical SMILES for 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole is Cc1ccc(C2=CCC(C)(c3nc4ccccc4o3)C=C2)cc1.
What is the InChIKey of 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole?
The InChIKey is ATCINQQGHSVFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO/c1-15-7-9-16(10-8-15)17-11-13-21(2,14-12-17)20-22-18-5-3-4-6-19(18)23-20/h3-13H,14H2,1-2H3.
What are the key properties of 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole?
2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole has a molecular weight of 301.39 g/mol, XLogP of 5.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-methyl-4-(4-methylphenyl)cyclohexa-2,4-dien-1-yl]-1,3-benzoxazole is sourced from PubChem (CID 90816110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).