C21H22ClF3N2O2 — CID 171622066
1-benzyl-N-[[4-chloro-2-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 171622066) has the molecular formula C21H22ClF3N2O2 and a molecular weight of 426.87 g/mol. Its IUPAC name is 1-benzyl-N-[[4-chloro-2-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-[[4-chloro-2-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171622066 |
| Molecular Formula | C21H22ClF3N2O2 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-benzyl-N-[[4-chloro-2-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1OC(F)(F)F)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22ClF3N2O2/c22-18-7-6-17(19(12-18)29-21(23,24)25)13-26-20(28)16-8-10-27(11-9-16)14-15-4-2-1-3-5-15/h1-7,12,16H,8-11,13-14H2,(H,26,28) |
| InChIKey | JXQRSWDORGKXOX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |