C14H22N2O3 — CID 171622541
(E,2E)-2-(hydroxymethylidene)-3-[(4-methoxycyclohexyl)amino]-5-methyliminopent-3-enal (PubChem CID 171622541) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (E,2E)-2-(hydroxymethylidene)-3-[(4-methoxycyclohexyl)amino]-5-methyliminopent-3-enal.
| Compound Name | (E,2E)-2-(hydroxymethylidene)-3-[(4-methoxycyclohexyl)amino]-5-methyliminopent-3-enal |
|---|---|
| PubChem CID | 171622541 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (E,2E)-2-(hydroxymethylidene)-3-[(4-methoxycyclohexyl)amino]-5-methyliminopent-3-enal |
| SMILES | C/N=C/C=C(NC1CCC(OC)CC1)\C(C=O)=C/O |
| InChI | InChI=1S/C14H22N2O3/c1-15-8-7-14(11(9-17)10-18)16-12-3-5-13(19-2)6-4-12/h7-10,12-13,16-17H,3-6H2,1-2H3/b11-9-,14-7+,15-8+ |
| InChIKey | UYGAHXPGFJXENY-VELLFWIGSA-N |
| XLogP | 1.76 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|